C17H20N4O6S3 — CID 146964982
N-[[3-[(2S,7R)-6-hydroxy-4-oxo-3-azatricyclo[6.2.1.02,7]undec-5-en-5-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide (PubChem CID 146964982) has the molecular formula C17H20N4O6S3 and a molecular weight of 472.57 g/mol. Its IUPAC name is N-[[3-[(2S,7R)-6-hydroxy-4-oxo-3-azatricyclo[6.2.1.02,7]undec-5-en-5-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide.
| Compound Name | N-[[3-[(2S,7R)-6-hydroxy-4-oxo-3-azatricyclo[6.2.1.02,7]undec-5-en-5-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 146964982 |
| Molecular Formula | C17H20N4O6S3 |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | N-[[3-[(2S,7R)-6-hydroxy-4-oxo-3-azatricyclo[6.2.1.02,7]undec-5-en-5-yl]-1,1-dioxo-4H-thieno[2,3-e][1,2,4]thiadiazin-7-yl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCc1csc2c1S(=O)(=O)N=C(C1=C(O)[C@@H]3C4CCC(C4)[C@@H]3NC1=O)N2 |
| InChI | InChI=1S/C17H20N4O6S3/c1-29(24,25)18-5-9-6-28-17-14(9)30(26,27)21-15(20-17)11-13(22)10-7-2-3-8(4-7)12(10)19-16(11)23/h6-8,10,12,18,22H,2-5H2,1H3,(H,19,23)(H,20,21)/t7?,8?,10-,12+/m1/s1 |
| InChIKey | ALHZQGAOLFHOPF-REWUKUAMSA-N |
| XLogP | 0.67 |
| TPSA | 154.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |