About 2-bromo-4-(1,3-dioxolan-2-yl)pyridine
2-bromo-4-(1,3-dioxolan-2-yl)pyridine (PubChem CID 14696507) has the molecular formula C8H8BrNO2
and a molecular weight of 230.06 g/mol. Its IUPAC name is 2-bromo-4-(1,3-dioxolan-2-yl)pyridine.
Molecular Properties
| Compound Name | 2-bromo-4-(1,3-dioxolan-2-yl)pyridine |
| PubChem CID | 14696507 |
| Molecular Formula | C8H8BrNO2 |
| Molecular Weight | 230.06 g/mol |
| Exact Mass | 228.97 |
| IUPAC Name | 2-bromo-4-(1,3-dioxolan-2-yl)pyridine |
| SMILES | Brc1cc(C2OCCO2)ccn1 |
| InChI | InChI=1S/C8H8BrNO2/c9-7-5-6(1-2-10-7)8-11-3-4-12-8/h1-2,5,8H,3-4H2 |
| InChIKey | OJLKBURHSSFUIL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.06 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-4-(1,3-dioxolan-2-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-(1,3-dioxolan-2-yl)pyridine?
The IUPAC name of 2-bromo-4-(1,3-dioxolan-2-yl)pyridine (CID 14696507) is 2-bromo-4-(1,3-dioxolan-2-yl)pyridine.
What is the SMILES notation for 2-bromo-4-(1,3-dioxolan-2-yl)pyridine?
The canonical SMILES for 2-bromo-4-(1,3-dioxolan-2-yl)pyridine is Brc1cc(C2OCCO2)ccn1.
What is the InChIKey of 2-bromo-4-(1,3-dioxolan-2-yl)pyridine?
The InChIKey is OJLKBURHSSFUIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrNO2/c9-7-5-6(1-2-10-7)8-11-3-4-12-8/h1-2,5,8H,3-4H2.
What are the key properties of 2-bromo-4-(1,3-dioxolan-2-yl)pyridine?
2-bromo-4-(1,3-dioxolan-2-yl)pyridine has a molecular weight of 230.06 g/mol, XLogP of 1.89, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-(1,3-dioxolan-2-yl)pyridine is sourced from PubChem (CID 14696507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).