About ethyl 3-chloro-2-cyanobenzoate
ethyl 3-chloro-2-cyanobenzoate (PubChem CID 14696600) has the molecular formula C10H8ClNO2
and a molecular weight of 209.63 g/mol. Its IUPAC name is ethyl 3-chloro-2-cyanobenzoate.
Molecular Properties
| Compound Name | ethyl 3-chloro-2-cyanobenzoate |
| PubChem CID | 14696600 |
| Molecular Formula | C10H8ClNO2 |
| Molecular Weight | 209.63 g/mol |
| Exact Mass | 209.02 |
| IUPAC Name | ethyl 3-chloro-2-cyanobenzoate |
| SMILES | CCOC(=O)c1cccc(Cl)c1C#N |
| InChI | InChI=1S/C10H8ClNO2/c1-2-14-10(13)7-4-3-5-9(11)8(7)6-12/h3-5H,2H2,1H3 |
| InChIKey | GUYFSTZUJMHPPG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.63 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 3-chloro-2-cyanobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-chloro-2-cyanobenzoate?
The IUPAC name of ethyl 3-chloro-2-cyanobenzoate (CID 14696600) is ethyl 3-chloro-2-cyanobenzoate.
What is the SMILES notation for ethyl 3-chloro-2-cyanobenzoate?
The canonical SMILES for ethyl 3-chloro-2-cyanobenzoate is CCOC(=O)c1cccc(Cl)c1C#N.
What is the InChIKey of ethyl 3-chloro-2-cyanobenzoate?
The InChIKey is GUYFSTZUJMHPPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClNO2/c1-2-14-10(13)7-4-3-5-9(11)8(7)6-12/h3-5H,2H2,1H3.
What are the key properties of ethyl 3-chloro-2-cyanobenzoate?
ethyl 3-chloro-2-cyanobenzoate has a molecular weight of 209.63 g/mol, XLogP of 2.39, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-chloro-2-cyanobenzoate is sourced from PubChem (CID 14696600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).