C25H25N5O — CID 1469699
4-(5-methylbenzotriazol-1-yl)-N,N-diphenylpiperidine-1-carboxamide (PubChem CID 1469699) has the molecular formula C25H25N5O and a molecular weight of 411.51 g/mol. Its IUPAC name is 4-(5-methylbenzotriazol-1-yl)-N,N-diphenylpiperidine-1-carboxamide.
| Compound Name | 4-(5-methylbenzotriazol-1-yl)-N,N-diphenylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 1469699 |
| Molecular Formula | C25H25N5O |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 4-(5-methylbenzotriazol-1-yl)-N,N-diphenylpiperidine-1-carboxamide |
| SMILES | Cc1ccc2c(c1)nnn2C1CCN(C(=O)N(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C25H25N5O/c1-19-12-13-24-23(18-19)26-27-30(24)22-14-16-28(17-15-22)25(31)29(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-13,18,22H,14-17H2,1H3 |
| InChIKey | ZKEZBJNEFAELHW-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |