C29H35F3N2O5 — CID 146970437
5-[2-(3-methoxypropoxy)phenyl]-9-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]-3,9-diazaspiro[5.5]undecan-2-one (PubChem CID 146970437) has the molecular formula C29H35F3N2O5 and a molecular weight of 548.60 g/mol. Its IUPAC name is 5-[2-(3-methoxypropoxy)phenyl]-9-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]-3,9-diazaspiro[5.5]undecan-2-one.
| Compound Name | 5-[2-(3-methoxypropoxy)phenyl]-9-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]-3,9-diazaspiro[5.5]undecan-2-one |
|---|---|
| PubChem CID | 146970437 |
| Molecular Formula | C29H35F3N2O5 |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | 5-[2-(3-methoxypropoxy)phenyl]-9-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]-3,9-diazaspiro[5.5]undecan-2-one |
| SMILES | COCCCOc1ccccc1C1CNC(=O)CC12CCN(C(=O)[C@](OC)(c1ccccc1)C(F)(F)F)CC2 |
| InChI | InChI=1S/C29H35F3N2O5/c1-37-17-8-18-39-24-12-7-6-11-22(24)23-20-33-25(35)19-27(23)13-15-34(16-14-27)26(36)28(38-2,29(30,31)32)21-9-4-3-5-10-21/h3-7,9-12,23H,8,13-20H2,1-2H3,(H,33,35)/t23?,28-/m1/s1 |
| InChIKey | AMHXPMJVGQVZEW-GBAZGAGXSA-N |
| XLogP | 4.42 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|