C22H26FN5O2 — CID 146976190
(2R,4R)-N-[(2S)-1-[(4-carbamimidoyl-3-fluorophenyl)methylamino]-1-oxopropan-2-yl]-4-phenylpyrrolidine-2-carboxamide (PubChem CID 146976190) has the molecular formula C22H26FN5O2 and a molecular weight of 411.48 g/mol. Its IUPAC name is (2R,4R)-N-[(2S)-1-[(4-carbamimidoyl-3-fluorophenyl)methylamino]-1-oxopropan-2-yl]-4-phenylpyrrolidine-2-carboxamide.
| Compound Name | (2R,4R)-N-[(2S)-1-[(4-carbamimidoyl-3-fluorophenyl)methylamino]-1-oxopropan-2-yl]-4-phenylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 146976190 |
| Molecular Formula | C22H26FN5O2 |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | (2R,4R)-N-[(2S)-1-[(4-carbamimidoyl-3-fluorophenyl)methylamino]-1-oxopropan-2-yl]-4-phenylpyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@H](C)NC(=O)[C@H]2C[C@H](c3ccccc3)CN2)cc1F |
| InChI | InChI=1S/C22H26FN5O2/c1-13(21(29)27-11-14-7-8-17(20(24)25)18(23)9-14)28-22(30)19-10-16(12-26-19)15-5-3-2-4-6-15/h2-9,13,16,19,26H,10-12H2,1H3,(H3,24,25)(H,27,29)(H,28,30)/t13-,16-,19+/m0/s1 |
| InChIKey | ANKBWYJXERYNII-IYJAJMOOSA-N |
| XLogP | 1.38 |
| TPSA | 120.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|