C18H18F3N5O3S — CID 146976377
1-(2-methylphenyl)-2-oxo-4-[2-(sulfamoylamino)ethylamino]-7-(trifluoromethyl)quinazoline (PubChem CID 146976377) has the molecular formula C18H18F3N5O3S and a molecular weight of 441.44 g/mol. Its IUPAC name is 1-(2-methylphenyl)-2-oxo-4-[2-(sulfamoylamino)ethylamino]-7-(trifluoromethyl)quinazoline.
| Compound Name | 1-(2-methylphenyl)-2-oxo-4-[2-(sulfamoylamino)ethylamino]-7-(trifluoromethyl)quinazoline |
|---|---|
| PubChem CID | 146976377 |
| Molecular Formula | C18H18F3N5O3S |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 1-(2-methylphenyl)-2-oxo-4-[2-(sulfamoylamino)ethylamino]-7-(trifluoromethyl)quinazoline |
| SMILES | Cc1ccccc1-n1c(=O)nc(NCCNS(N)(=O)=O)c2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C18H18F3N5O3S/c1-11-4-2-3-5-14(11)26-15-10-12(18(19,20)21)6-7-13(15)16(25-17(26)27)23-8-9-24-30(22,28)29/h2-7,10,24H,8-9H2,1H3,(H2,22,28,29)(H,23,25,27) |
| InChIKey | ANLAZYXRKMUTNU-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 119.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|