About 2-[4-(5-methylbenzotriazol-1-yl)piperidin-1-yl]-N,N-diphenylacetamide
2-[4-(5-methylbenzotriazol-1-yl)piperidin-1-yl]-N,N-diphenylacetamide (PubChem CID 1469769) has the molecular formula C26H27N5O
and a molecular weight of 425.54 g/mol. Its IUPAC name is 2-[4-(5-methylbenzotriazol-1-yl)piperidin-1-yl]-N,N-diphenylacetamide.
Molecular Properties
| Compound Name | 2-[4-(5-methylbenzotriazol-1-yl)piperidin-1-yl]-N,N-diphenylacetamide |
| PubChem CID | 1469769 |
| Molecular Formula | C26H27N5O |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 2-[4-(5-methylbenzotriazol-1-yl)piperidin-1-yl]-N,N-diphenylacetamide |
| SMILES | Cc1ccc2c(c1)nnn2C1CCN(CC(=O)N(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H27N5O/c1-20-12-13-25-24(18-20)27-28-31(25)23-14-16-29(17-15-23)19-26(32)30(21-8-4-2-5-9-21)22-10-6-3-7-11-22/h2-13,18,23H,14-17,19H2,1H3 |
| InChIKey | ZAKXFLVLSVNWTC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[4-(5-methylbenzotriazol-1-yl)piperidin-1-yl]-N,N-diphenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(5-methylbenzotriazol-1-yl)piperidin-1-yl]-N,N-diphenylacetamide?
The IUPAC name of 2-[4-(5-methylbenzotriazol-1-yl)piperidin-1-yl]-N,N-diphenylacetamide (CID 1469769) is 2-[4-(5-methylbenzotriazol-1-yl)piperidin-1-yl]-N,N-diphenylacetamide.
What is the SMILES notation for 2-[4-(5-methylbenzotriazol-1-yl)piperidin-1-yl]-N,N-diphenylacetamide?
The canonical SMILES for 2-[4-(5-methylbenzotriazol-1-yl)piperidin-1-yl]-N,N-diphenylacetamide is Cc1ccc2c(c1)nnn2C1CCN(CC(=O)N(c2ccccc2)c2ccccc2)CC1.
What is the InChIKey of 2-[4-(5-methylbenzotriazol-1-yl)piperidin-1-yl]-N,N-diphenylacetamide?
The InChIKey is ZAKXFLVLSVNWTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H27N5O/c1-20-12-13-25-24(18-20)27-28-31(25)23-14-16-29(17-15-23)19-26(32)30(21-8-4-2-5-9-21)22-10-6-3-7-11-22/h2-13,18,23H,14-17,19H2,1H3.
What are the key properties of 2-[4-(5-methylbenzotriazol-1-yl)piperidin-1-yl]-N,N-diphenylacetamide?
2-[4-(5-methylbenzotriazol-1-yl)piperidin-1-yl]-N,N-diphenylacetamide has a molecular weight of 425.54 g/mol, XLogP of 4.74, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(5-methylbenzotriazol-1-yl)piperidin-1-yl]-N,N-diphenylacetamide is sourced from PubChem (CID 1469769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).