C5H8N4O — CID 146977723
1,2,3,4,5,9-hexahydropurin-6-one (PubChem CID 146977723) has the molecular formula C5H8N4O and a molecular weight of 140.15 g/mol. Its IUPAC name is 1,2,3,4,5,9-hexahydropurin-6-one.
| Compound Name | 1,2,3,4,5,9-hexahydropurin-6-one |
|---|---|
| PubChem CID | 146977723 |
| Molecular Formula | C5H8N4O |
| Molecular Weight | 140.15 g/mol |
| Exact Mass | 140.07 |
| IUPAC Name | 1,2,3,4,5,9-hexahydropurin-6-one |
| SMILES | O=C1NCNC2NC=NC12 |
| InChI | InChI=1S/C5H8N4O/c10-5-3-4(7-1-6-3)8-2-9-5/h1,3-4,8H,2H2,(H,6,7)(H,9,10) |
| InChIKey | ANROTVPISXXXGC-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.15 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |