C19H22FN5O3S — CID 146985416
(3-amino-6-cyclopropylsulfonyl-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-2-yl)-(6-fluoro-1,2,3,4-tetrahydroquinolin-4-yl)methanone (PubChem CID 146985416) has the molecular formula C19H22FN5O3S and a molecular weight of 419.48 g/mol. Its IUPAC name is (3-amino-6-cyclopropylsulfonyl-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-2-yl)-(6-fluoro-1,2,3,4-tetrahydroquinolin-4-yl)methanone.
| Compound Name | (3-amino-6-cyclopropylsulfonyl-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-2-yl)-(6-fluoro-1,2,3,4-tetrahydroquinolin-4-yl)methanone |
|---|---|
| PubChem CID | 146985416 |
| Molecular Formula | C19H22FN5O3S |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | (3-amino-6-cyclopropylsulfonyl-5,7-dihydro-4H-pyrazolo[3,4-c]pyridin-2-yl)-(6-fluoro-1,2,3,4-tetrahydroquinolin-4-yl)methanone |
| SMILES | Nc1c2c(nn1C(=O)C1CCNc3ccc(F)cc31)CN(S(=O)(=O)C1CC1)CC2 |
| InChI | InChI=1S/C19H22FN5O3S/c20-11-1-4-16-15(9-11)13(5-7-22-16)19(26)25-18(21)14-6-8-24(10-17(14)23-25)29(27,28)12-2-3-12/h1,4,9,12-13,22H,2-3,5-8,10,21H2 |
| InChIKey | APDFQIOWBBCWDW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |