C22H17N3O3 — CID 14699106
7,19-dimethoxy-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaen-12-one (PubChem CID 14699106) has the molecular formula C22H17N3O3 and a molecular weight of 371.40 g/mol. Its IUPAC name is 7,19-dimethoxy-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaen-12-one.
| Compound Name | 7,19-dimethoxy-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaen-12-one |
|---|---|
| PubChem CID | 14699106 |
| Molecular Formula | C22H17N3O3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 7,19-dimethoxy-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4(9),5,7,10,15,17(22),18,20-nonaen-12-one |
| SMILES | COc1ccc2[nH]c3c4[nH]c5ccc(OC)cc5c4c4c(c3c2c1)CNC4=O |
| InChI | InChI=1S/C22H17N3O3/c1-27-10-3-5-15-12(7-10)17-14-9-23-22(26)19(14)18-13-8-11(28-2)4-6-16(13)25-21(18)20(17)24-15/h3-8,24-25H,9H2,1-2H3,(H,23,26) |
| InChIKey | KMSMXKJVYSKIMF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 79.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |