C21H15N3O2 — CID 14699109
19-methoxy-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17(22),18,20-nonaen-12-one (PubChem CID 14699109) has the molecular formula C21H15N3O2 and a molecular weight of 341.37 g/mol. Its IUPAC name is 19-methoxy-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17(22),18,20-nonaen-12-one.
| Compound Name | 19-methoxy-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17(22),18,20-nonaen-12-one |
|---|---|
| PubChem CID | 14699109 |
| Molecular Formula | C21H15N3O2 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 19-methoxy-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17(22),18,20-nonaen-12-one |
| SMILES | COc1ccc2[nH]c3c4[nH]c5ccccc5c4c4c(c3c2c1)CNC4=O |
| InChI | InChI=1S/C21H15N3O2/c1-26-10-6-7-15-12(8-10)16-13-9-22-21(25)18(13)17-11-4-2-3-5-14(11)23-20(17)19(16)24-15/h2-8,23-24H,9H2,1H3,(H,22,25) |
| InChIKey | ZNUNYZXACHPWBX-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 69.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |