C45H26N4O2 — CID 146992851
5-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]-13-oxa-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14,16,18-nonaene (PubChem CID 146992851) has the molecular formula C45H26N4O2 and a molecular weight of 654.73 g/mol. Its IUPAC name is 5-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]-13-oxa-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14,16,18-nonaene.
| Compound Name | 5-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]-13-oxa-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14,16,18-nonaene |
|---|---|
| PubChem CID | 146992851 |
| Molecular Formula | C45H26N4O2 |
| Molecular Weight | 654.73 g/mol |
| Exact Mass | 654.21 |
| IUPAC Name | 5-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzofuran-2-yl]-13-oxa-1-azapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14,16,18-nonaene |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4c(c3)oc3ccc(-c5ccc6c(c5)c5cccc7c5n6-c5ccccc5O7)cc34)n2)cc1 |
| InChI | InChI=1S/C45H26N4O2/c1-3-10-27(11-4-1)43-46-44(28-12-5-2-6-13-28)48-45(47-43)31-18-21-32-35-25-30(20-23-38(35)50-41(32)26-31)29-19-22-36-34(24-29)33-14-9-17-40-42(33)49(36)37-15-7-8-16-39(37)51-40/h1-26H |
| InChIKey | AQNOHBHQQJZNNR-UHFFFAOYSA-N |
| XLogP | 11.64 |
| TPSA | 65.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.73 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |