About 2-(2-methoxyphenyl)-2-(1,2,4-triazol-1-ylmethyl)hexanenitrile
2-(2-methoxyphenyl)-2-(1,2,4-triazol-1-ylmethyl)hexanenitrile (PubChem CID 14699394) has the molecular formula C16H20N4O
and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-2-(1,2,4-triazol-1-ylmethyl)hexanenitrile.
Molecular Properties
| Compound Name | 2-(2-methoxyphenyl)-2-(1,2,4-triazol-1-ylmethyl)hexanenitrile |
| PubChem CID | 14699394 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 2-(2-methoxyphenyl)-2-(1,2,4-triazol-1-ylmethyl)hexanenitrile |
| SMILES | CCCCC(C#N)(Cn1cncn1)c1ccccc1OC |
| InChI | InChI=1S/C16H20N4O/c1-3-4-9-16(10-17,11-20-13-18-12-19-20)14-7-5-6-8-15(14)21-2/h5-8,12-13H,3-4,9,11H2,1-2H3 |
| InChIKey | HRVMTBFBTHMNEH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-methoxyphenyl)-2-(1,2,4-triazol-1-ylmethyl)hexanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methoxyphenyl)-2-(1,2,4-triazol-1-ylmethyl)hexanenitrile?
The IUPAC name of 2-(2-methoxyphenyl)-2-(1,2,4-triazol-1-ylmethyl)hexanenitrile (CID 14699394) is 2-(2-methoxyphenyl)-2-(1,2,4-triazol-1-ylmethyl)hexanenitrile.
What is the SMILES notation for 2-(2-methoxyphenyl)-2-(1,2,4-triazol-1-ylmethyl)hexanenitrile?
The canonical SMILES for 2-(2-methoxyphenyl)-2-(1,2,4-triazol-1-ylmethyl)hexanenitrile is CCCCC(C#N)(Cn1cncn1)c1ccccc1OC.
What is the InChIKey of 2-(2-methoxyphenyl)-2-(1,2,4-triazol-1-ylmethyl)hexanenitrile?
The InChIKey is HRVMTBFBTHMNEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N4O/c1-3-4-9-16(10-17,11-20-13-18-12-19-20)14-7-5-6-8-15(14)21-2/h5-8,12-13H,3-4,9,11H2,1-2H3.
What are the key properties of 2-(2-methoxyphenyl)-2-(1,2,4-triazol-1-ylmethyl)hexanenitrile?
2-(2-methoxyphenyl)-2-(1,2,4-triazol-1-ylmethyl)hexanenitrile has a molecular weight of 284.36 g/mol, XLogP of 2.94, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methoxyphenyl)-2-(1,2,4-triazol-1-ylmethyl)hexanenitrile is sourced from PubChem (CID 14699394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).