About 1-phenyl-1-(1,3-thiazol-2-yl)pent-4-en-1-ol
1-phenyl-1-(1,3-thiazol-2-yl)pent-4-en-1-ol (PubChem CID 146994174) has the molecular formula C14H15NOS
and a molecular weight of 245.35 g/mol. Its IUPAC name is 1-phenyl-1-(1,3-thiazol-2-yl)pent-4-en-1-ol.
Molecular Properties
| Compound Name | 1-phenyl-1-(1,3-thiazol-2-yl)pent-4-en-1-ol |
| PubChem CID | 146994174 |
| Molecular Formula | C14H15NOS |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 1-phenyl-1-(1,3-thiazol-2-yl)pent-4-en-1-ol |
| SMILES | C=CCCC(O)(c1ccccc1)c1nccs1 |
| InChI | InChI=1S/C14H15NOS/c1-2-3-9-14(16,13-15-10-11-17-13)12-7-5-4-6-8-12/h2,4-8,10-11,16H,1,3,9H2 |
| InChIKey | AQTLQUCMXZZIPN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyl-1-(1,3-thiazol-2-yl)pent-4-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-1-(1,3-thiazol-2-yl)pent-4-en-1-ol?
The IUPAC name of 1-phenyl-1-(1,3-thiazol-2-yl)pent-4-en-1-ol (CID 146994174) is 1-phenyl-1-(1,3-thiazol-2-yl)pent-4-en-1-ol.
What is the SMILES notation for 1-phenyl-1-(1,3-thiazol-2-yl)pent-4-en-1-ol?
The canonical SMILES for 1-phenyl-1-(1,3-thiazol-2-yl)pent-4-en-1-ol is C=CCCC(O)(c1ccccc1)c1nccs1.
What is the InChIKey of 1-phenyl-1-(1,3-thiazol-2-yl)pent-4-en-1-ol?
The InChIKey is AQTLQUCMXZZIPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NOS/c1-2-3-9-14(16,13-15-10-11-17-13)12-7-5-4-6-8-12/h2,4-8,10-11,16H,1,3,9H2.
What are the key properties of 1-phenyl-1-(1,3-thiazol-2-yl)pent-4-en-1-ol?
1-phenyl-1-(1,3-thiazol-2-yl)pent-4-en-1-ol has a molecular weight of 245.35 g/mol, XLogP of 3.35, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-1-(1,3-thiazol-2-yl)pent-4-en-1-ol is sourced from PubChem (CID 146994174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).