C30H41NO3 — CID 14699679
octyl (2S,3aS,6aS)-1-(4-naphthalen-2-ylbutanoyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate (PubChem CID 14699679) has the molecular formula C30H41NO3 and a molecular weight of 463.66 g/mol. Its IUPAC name is octyl (2S,3aS,6aS)-1-(4-naphthalen-2-ylbutanoyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate.
| Compound Name | octyl (2S,3aS,6aS)-1-(4-naphthalen-2-ylbutanoyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 14699679 |
| Molecular Formula | C30H41NO3 |
| Molecular Weight | 463.66 g/mol |
| Exact Mass | 463.31 |
| IUPAC Name | octyl (2S,3aS,6aS)-1-(4-naphthalen-2-ylbutanoyl)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-2-carboxylate |
| SMILES | CCCCCCCCOC(=O)[C@@H]1C[C@@H]2CCC[C@@H]2N1C(=O)CCCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C30H41NO3/c1-2-3-4-5-6-9-20-34-30(33)28-22-26-15-11-16-27(26)31(28)29(32)17-10-12-23-18-19-24-13-7-8-14-25(24)21-23/h7-8,13-14,18-19,21,26-28H,2-6,9-12,15-17,20,22H2,1H3/t26-,27-,28-/m0/s1 |
| InChIKey | BSFXXXXEKUBBAU-KCHLEUMXSA-N |
| XLogP | 6.84 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.66 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|