C31H39ClO11 — CID 146998828
(E)-1-[3-chloro-4-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-2-[(2S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]hept-1-ene-3,5-dione (PubChem CID 146998828) has the molecular formula C31H39ClO11 and a molecular weight of 623.10 g/mol. Its IUPAC name is (E)-1-[3-chloro-4-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-2-[(2S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]hept-1-ene-3,5-dione.
| Compound Name | (E)-1-[3-chloro-4-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-2-[(2S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]hept-1-ene-3,5-dione |
|---|---|
| PubChem CID | 146998828 |
| Molecular Formula | C31H39ClO11 |
| Molecular Weight | 623.10 g/mol |
| Exact Mass | 622.22 |
| IUPAC Name | (E)-1-[3-chloro-4-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)-2-[(2S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]hept-1-ene-3,5-dione |
| SMILES | CCC(=O)CC(=O)/C=C/c1ccc(C2(OC)OOC23C2CC4CC(C2)CC3C4)c(Cl)c1O[C@@H]1OC(CO)[C@H](O)[C@H](O)C1O |
| InChI | InChI=1S/C31H39ClO11/c1-3-20(34)13-21(35)6-4-17-5-7-22(24(32)28(17)41-29-27(38)26(37)25(36)23(14-33)40-29)31(39-2)30(42-43-31)18-9-15-8-16(11-18)12-19(30)10-15/h4-7,15-16,18-19,23,25-27,29,33,36-38H,3,8-14H2,1-2H3/b6-4+/t15?,16?,18?,19?,23?,25-,26-,27?,29-,30?,31?/m0/s1 |
| InChIKey | ARQGWCKTJGLJKG-KHEIUVNLSA-N |
| XLogP | 2.43 |
| TPSA | 161.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.10 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|