About 2-amino-4-chloro-5,7-di(propan-2-yl)-1,3-benzothiazol-6-ol
2-amino-4-chloro-5,7-di(propan-2-yl)-1,3-benzothiazol-6-ol (PubChem CID 14700255) has the molecular formula C13H17ClN2OS
and a molecular weight of 284.81 g/mol. Its IUPAC name is 2-amino-4-chloro-5,7-di(propan-2-yl)-1,3-benzothiazol-6-ol.
Molecular Properties
| Compound Name | 2-amino-4-chloro-5,7-di(propan-2-yl)-1,3-benzothiazol-6-ol |
| PubChem CID | 14700255 |
| Molecular Formula | C13H17ClN2OS |
| Molecular Weight | 284.81 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-amino-4-chloro-5,7-di(propan-2-yl)-1,3-benzothiazol-6-ol |
| SMILES | CC(C)c1c(O)c(C(C)C)c2sc(N)nc2c1Cl |
| InChI | InChI=1S/C13H17ClN2OS/c1-5(2)7-9(14)10-12(18-13(15)16-10)8(6(3)4)11(7)17/h5-6,17H,1-4H3,(H2,15,16) |
| InChIKey | XCUGVVJZROCZRR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.81 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-4-chloro-5,7-di(propan-2-yl)-1,3-benzothiazol-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-chloro-5,7-di(propan-2-yl)-1,3-benzothiazol-6-ol?
The IUPAC name of 2-amino-4-chloro-5,7-di(propan-2-yl)-1,3-benzothiazol-6-ol (CID 14700255) is 2-amino-4-chloro-5,7-di(propan-2-yl)-1,3-benzothiazol-6-ol.
What is the SMILES notation for 2-amino-4-chloro-5,7-di(propan-2-yl)-1,3-benzothiazol-6-ol?
The canonical SMILES for 2-amino-4-chloro-5,7-di(propan-2-yl)-1,3-benzothiazol-6-ol is CC(C)c1c(O)c(C(C)C)c2sc(N)nc2c1Cl.
What is the InChIKey of 2-amino-4-chloro-5,7-di(propan-2-yl)-1,3-benzothiazol-6-ol?
The InChIKey is XCUGVVJZROCZRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClN2OS/c1-5(2)7-9(14)10-12(18-13(15)16-10)8(6(3)4)11(7)17/h5-6,17H,1-4H3,(H2,15,16).
What are the key properties of 2-amino-4-chloro-5,7-di(propan-2-yl)-1,3-benzothiazol-6-ol?
2-amino-4-chloro-5,7-di(propan-2-yl)-1,3-benzothiazol-6-ol has a molecular weight of 284.81 g/mol, XLogP of 4.48, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-chloro-5,7-di(propan-2-yl)-1,3-benzothiazol-6-ol is sourced from PubChem (CID 14700255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).