C20H16ClFN2O2 — CID 147004045
(3S)-1-(3-chloro-4-isocyanophenyl)-4-(3-fluoroindol-1-yl)-3-hydroxy-3-methylbutan-2-one (PubChem CID 147004045) has the molecular formula C20H16ClFN2O2 and a molecular weight of 370.81 g/mol. Its IUPAC name is (3S)-1-(3-chloro-4-isocyanophenyl)-4-(3-fluoroindol-1-yl)-3-hydroxy-3-methylbutan-2-one.
| Compound Name | (3S)-1-(3-chloro-4-isocyanophenyl)-4-(3-fluoroindol-1-yl)-3-hydroxy-3-methylbutan-2-one |
|---|---|
| PubChem CID | 147004045 |
| Molecular Formula | C20H16ClFN2O2 |
| Molecular Weight | 370.81 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | (3S)-1-(3-chloro-4-isocyanophenyl)-4-(3-fluoroindol-1-yl)-3-hydroxy-3-methylbutan-2-one |
| SMILES | [C-]#[N+]c1ccc(CC(=O)[C@@](C)(O)Cn2cc(F)c3ccccc32)cc1Cl |
| InChI | InChI=1S/C20H16ClFN2O2/c1-20(26,12-24-11-16(22)14-5-3-4-6-18(14)24)19(25)10-13-7-8-17(23-2)15(21)9-13/h3-9,11,26H,10,12H2,1H3/t20-/m0/s1 |
| InChIKey | ASPCVZWGONERHJ-FQEVSTJZSA-N |
| XLogP | 4.55 |
| TPSA | 46.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.81 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|