C40H42B2N2O4 — CID 147010691
3-[3-[3-[3-pyridin-3-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine (PubChem CID 147010691) has the molecular formula C40H42B2N2O4 and a molecular weight of 636.41 g/mol. Its IUPAC name is 3-[3-[3-[3-pyridin-3-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine.
| Compound Name | 3-[3-[3-[3-pyridin-3-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine |
|---|---|
| PubChem CID | 147010691 |
| Molecular Formula | C40H42B2N2O4 |
| Molecular Weight | 636.41 g/mol |
| Exact Mass | 636.33 |
| IUPAC Name | 3-[3-[3-[3-pyridin-3-yl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine |
| SMILES | CC1(C)OB(c2cc(-c3cccnc3)cc(-c3cccc(-c4cc(B5OC(C)(C)C(C)(C)O5)cc(-c5cccnc5)c4)c3)c2)OC1(C)C |
| InChI | InChI=1S/C40H42B2N2O4/c1-37(2)38(3,4)46-41(45-37)35-21-31(19-33(23-35)29-14-10-16-43-25-29)27-12-9-13-28(18-27)32-20-34(30-15-11-17-44-26-30)24-36(22-32)42-47-39(5,6)40(7,8)48-42/h9-26H,1-8H3 |
| InChIKey | ATURGWHTQPREOP-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.41 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|