C18H18F3N3O3 — CID 147012239
2-[3-[(4S,6S)-2-amino-4,6-bis(fluoromethyl)-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-1-(2-methyl-1,3-oxazol-4-yl)ethanone (PubChem CID 147012239) has the molecular formula C18H18F3N3O3 and a molecular weight of 381.35 g/mol. Its IUPAC name is 2-[3-[(4S,6S)-2-amino-4,6-bis(fluoromethyl)-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-1-(2-methyl-1,3-oxazol-4-yl)ethanone.
| Compound Name | 2-[3-[(4S,6S)-2-amino-4,6-bis(fluoromethyl)-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-1-(2-methyl-1,3-oxazol-4-yl)ethanone |
|---|---|
| PubChem CID | 147012239 |
| Molecular Formula | C18H18F3N3O3 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 2-[3-[(4S,6S)-2-amino-4,6-bis(fluoromethyl)-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-1-(2-methyl-1,3-oxazol-4-yl)ethanone |
| SMILES | Cc1nc(C(=O)Cc2ccc(F)c([C@]3(CF)C[C@@H](CF)OC(N)=N3)c2)co1 |
| InChI | InChI=1S/C18H18F3N3O3/c1-10-23-15(8-26-10)16(25)5-11-2-3-14(21)13(4-11)18(9-20)6-12(7-19)27-17(22)24-18/h2-4,8,12H,5-7,9H2,1H3,(H2,22,24)/t12-,18+/m0/s1 |
| InChIKey | AUBYIKOJQGBWBJ-KPZWWZAWSA-N |
| XLogP | 2.79 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |