C25H32FN3O4 — CID 147015573
1-[7-[5-(4-fluorophenyl)-1,2-oxazol-3-yl]-7-oxoheptyl]-N-[(1S,2S)-2-hydroxycyclopentyl]azetidine-3-carboxamide (PubChem CID 147015573) has the molecular formula C25H32FN3O4 and a molecular weight of 457.55 g/mol. Its IUPAC name is 1-[7-[5-(4-fluorophenyl)-1,2-oxazol-3-yl]-7-oxoheptyl]-N-[(1S,2S)-2-hydroxycyclopentyl]azetidine-3-carboxamide.
| Compound Name | 1-[7-[5-(4-fluorophenyl)-1,2-oxazol-3-yl]-7-oxoheptyl]-N-[(1S,2S)-2-hydroxycyclopentyl]azetidine-3-carboxamide |
|---|---|
| PubChem CID | 147015573 |
| Molecular Formula | C25H32FN3O4 |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | 1-[7-[5-(4-fluorophenyl)-1,2-oxazol-3-yl]-7-oxoheptyl]-N-[(1S,2S)-2-hydroxycyclopentyl]azetidine-3-carboxamide |
| SMILES | O=C(CCCCCCN1CC(C(=O)N[C@H]2CCC[C@@H]2O)C1)c1cc(-c2ccc(F)cc2)on1 |
| InChI | InChI=1S/C25H32FN3O4/c26-19-11-9-17(10-12-19)24-14-21(28-33-24)23(31)7-3-1-2-4-13-29-15-18(16-29)25(32)27-20-6-5-8-22(20)30/h9-12,14,18,20,22,30H,1-8,13,15-16H2,(H,27,32)/t20-,22-/m0/s1 |
| InChIKey | AURWFISOWQKCFJ-UNMCSNQZSA-N |
| XLogP | 3.58 |
| TPSA | 95.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|