About [(3E)-7-azidohepta-1,3-dien-3-yl] N,N-di(propan-2-yl)carbamate
[(3E)-7-azidohepta-1,3-dien-3-yl] N,N-di(propan-2-yl)carbamate (PubChem CID 14701666) has the molecular formula C14H24N4O2
and a molecular weight of 280.37 g/mol. Its IUPAC name is [(3E)-7-azidohepta-1,3-dien-3-yl] N,N-di(propan-2-yl)carbamate.
Molecular Properties
| Compound Name | [(3E)-7-azidohepta-1,3-dien-3-yl] N,N-di(propan-2-yl)carbamate |
| PubChem CID | 14701666 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | [(3E)-7-azidohepta-1,3-dien-3-yl] N,N-di(propan-2-yl)carbamate |
| SMILES | C=C/C(=C\CCCN=[N+]=[N-])OC(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C14H24N4O2/c1-6-13(9-7-8-10-16-17-15)20-14(19)18(11(2)3)12(4)5/h6,9,11-12H,1,7-8,10H2,2-5H3/b13-9+ |
| InChIKey | JTWKTKOTKCLZRZ-UKTHLTGXSA-N |
| XLogP | 4.40 |
| TPSA | 78.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze [(3E)-7-azidohepta-1,3-dien-3-yl] N,N-di(propan-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3E)-7-azidohepta-1,3-dien-3-yl] N,N-di(propan-2-yl)carbamate?
The IUPAC name of [(3E)-7-azidohepta-1,3-dien-3-yl] N,N-di(propan-2-yl)carbamate (CID 14701666) is [(3E)-7-azidohepta-1,3-dien-3-yl] N,N-di(propan-2-yl)carbamate.
What is the SMILES notation for [(3E)-7-azidohepta-1,3-dien-3-yl] N,N-di(propan-2-yl)carbamate?
The canonical SMILES for [(3E)-7-azidohepta-1,3-dien-3-yl] N,N-di(propan-2-yl)carbamate is C=C/C(=C\CCCN=[N+]=[N-])OC(=O)N(C(C)C)C(C)C.
What is the InChIKey of [(3E)-7-azidohepta-1,3-dien-3-yl] N,N-di(propan-2-yl)carbamate?
The InChIKey is JTWKTKOTKCLZRZ-UKTHLTGXSA-N. The full InChI is InChI=1S/C14H24N4O2/c1-6-13(9-7-8-10-16-17-15)20-14(19)18(11(2)3)12(4)5/h6,9,11-12H,1,7-8,10H2,2-5H3/b13-9+.
What are the key properties of [(3E)-7-azidohepta-1,3-dien-3-yl] N,N-di(propan-2-yl)carbamate?
[(3E)-7-azidohepta-1,3-dien-3-yl] N,N-di(propan-2-yl)carbamate has a molecular weight of 280.37 g/mol, XLogP of 4.40, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3E)-7-azidohepta-1,3-dien-3-yl] N,N-di(propan-2-yl)carbamate is sourced from PubChem (CID 14701666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).