C11H19NO2 — CID 14701676
7-(1-ethoxyethoxy)-2,3,5,8-tetrahydro-1H-pyrrolizine (PubChem CID 14701676) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 7-(1-ethoxyethoxy)-2,3,5,8-tetrahydro-1H-pyrrolizine.
| Compound Name | 7-(1-ethoxyethoxy)-2,3,5,8-tetrahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 14701676 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 7-(1-ethoxyethoxy)-2,3,5,8-tetrahydro-1H-pyrrolizine |
| SMILES | CCOC(C)OC1=CCN2CCCC12 |
| InChI | InChI=1S/C11H19NO2/c1-3-13-9(2)14-11-6-8-12-7-4-5-10(11)12/h6,9-10H,3-5,7-8H2,1-2H3 |
| InChIKey | JSLROKGUVHQXAI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|