About CID 147019941
CID 147019941 (PubChem CID 147019941) has the molecular formula C6H11I2N2-
and a molecular weight of 364.98 g/mol.
Molecular Properties
| Compound Name | CID 147019941 |
| PubChem CID | 147019941 |
| Molecular Formula | C6H11I2N2- |
| Molecular Weight | 364.98 g/mol |
| Exact Mass | 364.90 |
| IUPAC Name | — |
| SMILES | C=CC1(C)CN(C)[I-]N1I |
| InChI | InChI=1S/C6H11I2N2/c1-4-6(2)5-9(3)8-10(6)7/h4H,1,5H2,2-3H3/q-1 |
| InChIKey | PZBAXNYSGRTZHA-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.98 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze CID 147019941 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 147019941?
The IUPAC name of CID 147019941 (CID 147019941) is not available.
What is the SMILES notation for CID 147019941?
The canonical SMILES for CID 147019941 is C=CC1(C)CN(C)[I-]N1I.
What is the InChIKey of CID 147019941?
The InChIKey is PZBAXNYSGRTZHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11I2N2/c1-4-6(2)5-9(3)8-10(6)7/h4H,1,5H2,2-3H3/q-1.
What are the key properties of CID 147019941?
CID 147019941 has a molecular weight of 364.98 g/mol, XLogP of -1.55, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 147019941 is sourced from PubChem (CID 147019941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).