C24H29N5O — CID 147024840
(4R)-6-[(4S)-6-(1-amino-3-methyliminoprop-1-en-2-yl)-4-methyl-3,4-dihydro-2H-quinolin-1-yl]-4-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one (PubChem CID 147024840) has the molecular formula C24H29N5O and a molecular weight of 403.53 g/mol. Its IUPAC name is (4R)-6-[(4S)-6-(1-amino-3-methyliminoprop-1-en-2-yl)-4-methyl-3,4-dihydro-2H-quinolin-1-yl]-4-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one.
| Compound Name | (4R)-6-[(4S)-6-(1-amino-3-methyliminoprop-1-en-2-yl)-4-methyl-3,4-dihydro-2H-quinolin-1-yl]-4-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one |
|---|---|
| PubChem CID | 147024840 |
| Molecular Formula | C24H29N5O |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | (4R)-6-[(4S)-6-(1-amino-3-methyliminoprop-1-en-2-yl)-4-methyl-3,4-dihydro-2H-quinolin-1-yl]-4-methyl-1,3,4,5-tetrahydro-1,5-benzodiazepin-2-one |
| SMILES | C/N=C/C(=CN)c1ccc2c(c1)[C@@H](C)CCN2c1cccc2c1N[C@H](C)CC(=O)N2 |
| InChI | InChI=1S/C24H29N5O/c1-15-9-10-29(21-8-7-17(12-19(15)21)18(13-25)14-26-3)22-6-4-5-20-24(22)27-16(2)11-23(30)28-20/h4-8,12-16,27H,9-11,25H2,1-3H3,(H,28,30)/b18-13?,26-14+/t15-,16+/m0/s1 |
| InChIKey | HNWLYNHGTAPSBW-YSVCFMSJSA-N |
| XLogP | 4.47 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|