About 4,6-dioxo-2-phenyl-2-(trifluoromethyl)cyclohexane-1,3-dicarbonitrile
4,6-dioxo-2-phenyl-2-(trifluoromethyl)cyclohexane-1,3-dicarbonitrile (PubChem CID 147025382) has the molecular formula C15H9F3N2O2
and a molecular weight of 306.24 g/mol. Its IUPAC name is 4,6-dioxo-2-phenyl-2-(trifluoromethyl)cyclohexane-1,3-dicarbonitrile.
Molecular Properties
| Compound Name | 4,6-dioxo-2-phenyl-2-(trifluoromethyl)cyclohexane-1,3-dicarbonitrile |
| PubChem CID | 147025382 |
| Molecular Formula | C15H9F3N2O2 |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 4,6-dioxo-2-phenyl-2-(trifluoromethyl)cyclohexane-1,3-dicarbonitrile |
| SMILES | N#CC1C(=O)CC(=O)C(C#N)C1(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C15H9F3N2O2/c16-15(17,18)14(9-4-2-1-3-5-9)10(7-19)12(21)6-13(22)11(14)8-20/h1-5,10-11H,6H2 |
| InChIKey | AWNRNSPQISCWIT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 81.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4,6-dioxo-2-phenyl-2-(trifluoromethyl)cyclohexane-1,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dioxo-2-phenyl-2-(trifluoromethyl)cyclohexane-1,3-dicarbonitrile?
The IUPAC name of 4,6-dioxo-2-phenyl-2-(trifluoromethyl)cyclohexane-1,3-dicarbonitrile (CID 147025382) is 4,6-dioxo-2-phenyl-2-(trifluoromethyl)cyclohexane-1,3-dicarbonitrile.
What is the SMILES notation for 4,6-dioxo-2-phenyl-2-(trifluoromethyl)cyclohexane-1,3-dicarbonitrile?
The canonical SMILES for 4,6-dioxo-2-phenyl-2-(trifluoromethyl)cyclohexane-1,3-dicarbonitrile is N#CC1C(=O)CC(=O)C(C#N)C1(c1ccccc1)C(F)(F)F.
What is the InChIKey of 4,6-dioxo-2-phenyl-2-(trifluoromethyl)cyclohexane-1,3-dicarbonitrile?
The InChIKey is AWNRNSPQISCWIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9F3N2O2/c16-15(17,18)14(9-4-2-1-3-5-9)10(7-19)12(21)6-13(22)11(14)8-20/h1-5,10-11H,6H2.
What are the key properties of 4,6-dioxo-2-phenyl-2-(trifluoromethyl)cyclohexane-1,3-dicarbonitrile?
4,6-dioxo-2-phenyl-2-(trifluoromethyl)cyclohexane-1,3-dicarbonitrile has a molecular weight of 306.24 g/mol, XLogP of 2.31, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dioxo-2-phenyl-2-(trifluoromethyl)cyclohexane-1,3-dicarbonitrile is sourced from PubChem (CID 147025382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).