C14H27N3O2 — CID 147025424
tert-butyl (2S)-2-(N'-butan-2-ylcarbamimidoyl)pyrrolidine-1-carboxylate (PubChem CID 147025424) has the molecular formula C14H27N3O2 and a molecular weight of 269.39 g/mol. Its IUPAC name is tert-butyl (2S)-2-(N'-butan-2-ylcarbamimidoyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-(N'-butan-2-ylcarbamimidoyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 147025424 |
| Molecular Formula | C14H27N3O2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | tert-butyl (2S)-2-(N'-butan-2-ylcarbamimidoyl)pyrrolidine-1-carboxylate |
| SMILES | CCC(C)/N=C(\N)[C@@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H27N3O2/c1-6-10(2)16-12(15)11-8-7-9-17(11)13(18)19-14(3,4)5/h10-11H,6-9H2,1-5H3,(H2,15,16)/t10?,11-/m0/s1 |
| InChIKey | AWNWSUNKTVTQOV-DTIOYNMSSA-N |
| XLogP | 2.54 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|