C55H59N3O10 — CID 14702907
2-[[3-azido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]-6-methoxy-3,4,5-tris(phenylmethoxy)oxane (PubChem CID 14702907) has the molecular formula C55H59N3O10 and a molecular weight of 922.09 g/mol. Its IUPAC name is 2-[[3-azido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]-6-methoxy-3,4,5-tris(phenylmethoxy)oxane.
| Compound Name | 2-[[3-azido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]-6-methoxy-3,4,5-tris(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 14702907 |
| Molecular Formula | C55H59N3O10 |
| Molecular Weight | 922.09 g/mol |
| Exact Mass | 921.42 |
| IUPAC Name | 2-[[3-azido-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxymethyl]-6-methoxy-3,4,5-tris(phenylmethoxy)oxane |
| SMILES | COC1OC(COC2OC(COCc3ccccc3)C(OCc3ccccc3)C(OCc3ccccc3)C2N=[N+]=[N-])C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C55H59N3O10/c1-59-55-53(65-37-45-30-18-7-19-31-45)52(64-36-44-28-16-6-17-29-44)50(62-34-42-24-12-4-13-25-42)47(68-55)39-66-54-48(57-58-56)51(63-35-43-26-14-5-15-27-43)49(61-33-41-22-10-3-11-23-41)46(67-54)38-60-32-40-20-8-2-9-21-40/h2-31,46-55H,32-39H2,1H3 |
| InChIKey | HRKQPNNXEGNRPS-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 141.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 922.09 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|