About N-(2-diazenylethyl)-2,2-dimethylpropanamide
N-(2-diazenylethyl)-2,2-dimethylpropanamide (PubChem CID 147030437) has the molecular formula C7H15N3O
and a molecular weight of 157.22 g/mol. Its IUPAC name is N-(2-diazenylethyl)-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-(2-diazenylethyl)-2,2-dimethylpropanamide |
| PubChem CID | 147030437 |
| Molecular Formula | C7H15N3O |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.12 |
| IUPAC Name | N-(2-diazenylethyl)-2,2-dimethylpropanamide |
| SMILES | [H]/N=N/CCNC(=O)C(C)(C)C |
| InChI | InChI=1S/C7H15N3O/c1-7(2,3)6(11)9-4-5-10-8/h8H,4-5H2,1-3H3,(H,9,11)/b10-8+ |
| InChIKey | AXMKOZWHGKSDMC-CSKARUKUSA-N |
| XLogP | 1.18 |
| TPSA | 65.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(2-diazenylethyl)-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-diazenylethyl)-2,2-dimethylpropanamide?
The IUPAC name of N-(2-diazenylethyl)-2,2-dimethylpropanamide (CID 147030437) is N-(2-diazenylethyl)-2,2-dimethylpropanamide.
What is the SMILES notation for N-(2-diazenylethyl)-2,2-dimethylpropanamide?
The canonical SMILES for N-(2-diazenylethyl)-2,2-dimethylpropanamide is [H]/N=N/CCNC(=O)C(C)(C)C.
What is the InChIKey of N-(2-diazenylethyl)-2,2-dimethylpropanamide?
The InChIKey is AXMKOZWHGKSDMC-CSKARUKUSA-N. The full InChI is InChI=1S/C7H15N3O/c1-7(2,3)6(11)9-4-5-10-8/h8H,4-5H2,1-3H3,(H,9,11)/b10-8+.
What are the key properties of N-(2-diazenylethyl)-2,2-dimethylpropanamide?
N-(2-diazenylethyl)-2,2-dimethylpropanamide has a molecular weight of 157.22 g/mol, XLogP of 1.18, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-diazenylethyl)-2,2-dimethylpropanamide is sourced from PubChem (CID 147030437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).