C20H30F2O3 — CID 147033652
2-[8-(2,2-difluoropropoxy)octyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione (PubChem CID 147033652) has the molecular formula C20H30F2O3 and a molecular weight of 356.45 g/mol. Its IUPAC name is 2-[8-(2,2-difluoropropoxy)octyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[8-(2,2-difluoropropoxy)octyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 147033652 |
| Molecular Formula | C20H30F2O3 |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 2-[8-(2,2-difluoropropoxy)octyl]-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(C)C(=O)C(CCCCCCCCOCC(C)(F)F)=C(C)C1=O |
| InChI | InChI=1S/C20H30F2O3/c1-14-15(2)19(24)17(16(3)18(14)23)11-9-7-5-6-8-10-12-25-13-20(4,21)22/h5-13H2,1-4H3 |
| InChIKey | AYBRUDKYNUSCIC-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|