About 2-tert-butyl-4-methyl-5H-pyrrolo[3,2-d]pyrimidine
2-tert-butyl-4-methyl-5H-pyrrolo[3,2-d]pyrimidine (PubChem CID 147039934) has the molecular formula C11H15N3
and a molecular weight of 189.26 g/mol. Its IUPAC name is 2-tert-butyl-4-methyl-5H-pyrrolo[3,2-d]pyrimidine.
Molecular Properties
| Compound Name | 2-tert-butyl-4-methyl-5H-pyrrolo[3,2-d]pyrimidine |
| PubChem CID | 147039934 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 2-tert-butyl-4-methyl-5H-pyrrolo[3,2-d]pyrimidine |
| SMILES | Cc1nc(C(C)(C)C)nc2cc[nH]c12 |
| InChI | InChI=1S/C11H15N3/c1-7-9-8(5-6-12-9)14-10(13-7)11(2,3)4/h5-6,12H,1-4H3 |
| InChIKey | AZGFKHBTXVNONW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-tert-butyl-4-methyl-5H-pyrrolo[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-4-methyl-5H-pyrrolo[3,2-d]pyrimidine?
The IUPAC name of 2-tert-butyl-4-methyl-5H-pyrrolo[3,2-d]pyrimidine (CID 147039934) is 2-tert-butyl-4-methyl-5H-pyrrolo[3,2-d]pyrimidine.
What is the SMILES notation for 2-tert-butyl-4-methyl-5H-pyrrolo[3,2-d]pyrimidine?
The canonical SMILES for 2-tert-butyl-4-methyl-5H-pyrrolo[3,2-d]pyrimidine is Cc1nc(C(C)(C)C)nc2cc[nH]c12.
What is the InChIKey of 2-tert-butyl-4-methyl-5H-pyrrolo[3,2-d]pyrimidine?
The InChIKey is AZGFKHBTXVNONW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3/c1-7-9-8(5-6-12-9)14-10(13-7)11(2,3)4/h5-6,12H,1-4H3.
What are the key properties of 2-tert-butyl-4-methyl-5H-pyrrolo[3,2-d]pyrimidine?
2-tert-butyl-4-methyl-5H-pyrrolo[3,2-d]pyrimidine has a molecular weight of 189.26 g/mol, XLogP of 2.56, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-4-methyl-5H-pyrrolo[3,2-d]pyrimidine is sourced from PubChem (CID 147039934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).