About 8-[(3R,5S)-3-ethyl-5-methylpiperidin-1-yl]pyrido[2,3-b]pyrazine
8-[(3R,5S)-3-ethyl-5-methylpiperidin-1-yl]pyrido[2,3-b]pyrazine (PubChem CID 147040017) has the molecular formula C15H20N4
and a molecular weight of 256.35 g/mol. Its IUPAC name is 8-[(3R,5S)-3-ethyl-5-methylpiperidin-1-yl]pyrido[2,3-b]pyrazine.
Molecular Properties
| Compound Name | 8-[(3R,5S)-3-ethyl-5-methylpiperidin-1-yl]pyrido[2,3-b]pyrazine |
| PubChem CID | 147040017 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 8-[(3R,5S)-3-ethyl-5-methylpiperidin-1-yl]pyrido[2,3-b]pyrazine |
| SMILES | CC[C@@H]1C[C@H](C)CN(c2ccnc3nccnc23)C1 |
| InChI | InChI=1S/C15H20N4/c1-3-12-8-11(2)9-19(10-12)13-4-5-17-15-14(13)16-6-7-18-15/h4-7,11-12H,3,8-10H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | AZGPDGVEPRKSBN-NWDGAFQWSA-N |
| XLogP | 2.90 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-[(3R,5S)-3-ethyl-5-methylpiperidin-1-yl]pyrido[2,3-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(3R,5S)-3-ethyl-5-methylpiperidin-1-yl]pyrido[2,3-b]pyrazine?
The IUPAC name of 8-[(3R,5S)-3-ethyl-5-methylpiperidin-1-yl]pyrido[2,3-b]pyrazine (CID 147040017) is 8-[(3R,5S)-3-ethyl-5-methylpiperidin-1-yl]pyrido[2,3-b]pyrazine.
What is the SMILES notation for 8-[(3R,5S)-3-ethyl-5-methylpiperidin-1-yl]pyrido[2,3-b]pyrazine?
The canonical SMILES for 8-[(3R,5S)-3-ethyl-5-methylpiperidin-1-yl]pyrido[2,3-b]pyrazine is CC[C@@H]1C[C@H](C)CN(c2ccnc3nccnc23)C1.
What is the InChIKey of 8-[(3R,5S)-3-ethyl-5-methylpiperidin-1-yl]pyrido[2,3-b]pyrazine?
The InChIKey is AZGPDGVEPRKSBN-NWDGAFQWSA-N. The full InChI is InChI=1S/C15H20N4/c1-3-12-8-11(2)9-19(10-12)13-4-5-17-15-14(13)16-6-7-18-15/h4-7,11-12H,3,8-10H2,1-2H3/t11-,12+/m0/s1.
What are the key properties of 8-[(3R,5S)-3-ethyl-5-methylpiperidin-1-yl]pyrido[2,3-b]pyrazine?
8-[(3R,5S)-3-ethyl-5-methylpiperidin-1-yl]pyrido[2,3-b]pyrazine has a molecular weight of 256.35 g/mol, XLogP of 2.90, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(3R,5S)-3-ethyl-5-methylpiperidin-1-yl]pyrido[2,3-b]pyrazine is sourced from PubChem (CID 147040017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).