About 2-(4-hydroxyphenyl)ethyl 4-methoxybenzoate
2-(4-hydroxyphenyl)ethyl 4-methoxybenzoate (PubChem CID 14704104) has the molecular formula C16H16O4
and a molecular weight of 272.30 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)ethyl 4-methoxybenzoate.
Molecular Properties
| Compound Name | 2-(4-hydroxyphenyl)ethyl 4-methoxybenzoate |
| PubChem CID | 14704104 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2-(4-hydroxyphenyl)ethyl 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCCc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C16H16O4/c1-19-15-8-4-13(5-9-15)16(18)20-11-10-12-2-6-14(17)7-3-12/h2-9,17H,10-11H2,1H3 |
| InChIKey | DSMAYKYXHOGICG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-hydroxyphenyl)ethyl 4-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-hydroxyphenyl)ethyl 4-methoxybenzoate?
The IUPAC name of 2-(4-hydroxyphenyl)ethyl 4-methoxybenzoate (CID 14704104) is 2-(4-hydroxyphenyl)ethyl 4-methoxybenzoate.
What is the SMILES notation for 2-(4-hydroxyphenyl)ethyl 4-methoxybenzoate?
The canonical SMILES for 2-(4-hydroxyphenyl)ethyl 4-methoxybenzoate is COc1ccc(C(=O)OCCc2ccc(O)cc2)cc1.
What is the InChIKey of 2-(4-hydroxyphenyl)ethyl 4-methoxybenzoate?
The InChIKey is DSMAYKYXHOGICG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O4/c1-19-15-8-4-13(5-9-15)16(18)20-11-10-12-2-6-14(17)7-3-12/h2-9,17H,10-11H2,1H3.
What are the key properties of 2-(4-hydroxyphenyl)ethyl 4-methoxybenzoate?
2-(4-hydroxyphenyl)ethyl 4-methoxybenzoate has a molecular weight of 272.30 g/mol, XLogP of 2.80, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxyphenyl)ethyl 4-methoxybenzoate is sourced from PubChem (CID 14704104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).