About 8-bromo-1,9-dimethylpurin-6-imine
8-bromo-1,9-dimethylpurin-6-imine (PubChem CID 14704115) has the molecular formula C7H8BrN5
and a molecular weight of 242.08 g/mol. Its IUPAC name is 8-bromo-1,9-dimethylpurin-6-imine.
Molecular Properties
| Compound Name | 8-bromo-1,9-dimethylpurin-6-imine |
| PubChem CID | 14704115 |
| Molecular Formula | C7H8BrN5 |
| Molecular Weight | 242.08 g/mol |
| Exact Mass | 241.00 |
| IUPAC Name | 8-bromo-1,9-dimethylpurin-6-imine |
| SMILES | [H]/N=c1/c2nc(Br)n(C)c2ncn1C |
| InChI | InChI=1S/C7H8BrN5/c1-12-3-10-6-4(5(12)9)11-7(8)13(6)2/h3,9H,1-2H3/b9-5- |
| InChIKey | LWAZAIJSRDRETJ-UITAMQMPSA-N |
| XLogP | 0.55 |
| TPSA | 59.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.08 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-bromo-1,9-dimethylpurin-6-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-1,9-dimethylpurin-6-imine?
The IUPAC name of 8-bromo-1,9-dimethylpurin-6-imine (CID 14704115) is 8-bromo-1,9-dimethylpurin-6-imine.
What is the SMILES notation for 8-bromo-1,9-dimethylpurin-6-imine?
The canonical SMILES for 8-bromo-1,9-dimethylpurin-6-imine is [H]/N=c1/c2nc(Br)n(C)c2ncn1C.
What is the InChIKey of 8-bromo-1,9-dimethylpurin-6-imine?
The InChIKey is LWAZAIJSRDRETJ-UITAMQMPSA-N. The full InChI is InChI=1S/C7H8BrN5/c1-12-3-10-6-4(5(12)9)11-7(8)13(6)2/h3,9H,1-2H3/b9-5-.
What are the key properties of 8-bromo-1,9-dimethylpurin-6-imine?
8-bromo-1,9-dimethylpurin-6-imine has a molecular weight of 242.08 g/mol, XLogP of 0.55, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-1,9-dimethylpurin-6-imine is sourced from PubChem (CID 14704115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).