C14H19BO3 — CID 147041786
(3R)-3-ethyl-5,11,11-trimethyl-2,9,12-trioxa-1-boratricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene (PubChem CID 147041786) has the molecular formula C14H19BO3 and a molecular weight of 246.11 g/mol. Its IUPAC name is (3R)-3-ethyl-5,11,11-trimethyl-2,9,12-trioxa-1-boratricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene.
| Compound Name | (3R)-3-ethyl-5,11,11-trimethyl-2,9,12-trioxa-1-boratricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene |
|---|---|
| PubChem CID | 147041786 |
| Molecular Formula | C14H19BO3 |
| Molecular Weight | 246.11 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | (3R)-3-ethyl-5,11,11-trimethyl-2,9,12-trioxa-1-boratricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene |
| SMILES | CC[C@H]1OB2OC(C)(C)COc3ccc(C)c1c32 |
| InChI | InChI=1S/C14H19BO3/c1-5-10-12-9(2)6-7-11-13(12)15(17-10)18-14(3,4)8-16-11/h6-7,10H,5,8H2,1-4H3/t10-/m1/s1 |
| InChIKey | AZOXEMSTCJSEKZ-SNVBAGLBSA-N |
| XLogP | 2.36 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.11 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|