C23H34O6SSi — CID 14704264
[(Z)-3-[(4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxo-2-phenylsulfanylprop-1-enyl] acetate (PubChem CID 14704264) has the molecular formula C23H34O6SSi and a molecular weight of 466.67 g/mol. Its IUPAC name is [(Z)-3-[(4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxo-2-phenylsulfanylprop-1-enyl] acetate.
| Compound Name | [(Z)-3-[(4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxo-2-phenylsulfanylprop-1-enyl] acetate |
|---|---|
| PubChem CID | 14704264 |
| Molecular Formula | C23H34O6SSi |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | [(Z)-3-[(4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxo-2-phenylsulfanylprop-1-enyl] acetate |
| SMILES | CC(=O)O/C=C(\Sc1ccccc1)C(=O)[C@@H]1OC(C)(C)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H34O6SSi/c1-16(24)26-15-19(30-17-12-10-9-11-13-17)20(25)21-18(28-23(5,6)29-21)14-27-31(7,8)22(2,3)4/h9-13,15,18,21H,14H2,1-8H3/b19-15-/t18-,21-/m1/s1 |
| InChIKey | BPMSPKZPMGFTIH-HHCWQNFWSA-N |
| XLogP | 5.29 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|