C22H30N2O3 — CID 14704379
tert-butyl N-[(2S,3R,4R)-4-amino-3-hydroxy-1,5-diphenylpentan-2-yl]carbamate (PubChem CID 14704379) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R,4R)-4-amino-3-hydroxy-1,5-diphenylpentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R,4R)-4-amino-3-hydroxy-1,5-diphenylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 14704379 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | tert-butyl N-[(2S,3R,4R)-4-amino-3-hydroxy-1,5-diphenylpentan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)[C@H](O)[C@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C22H30N2O3/c1-22(2,3)27-21(26)24-19(15-17-12-8-5-9-13-17)20(25)18(23)14-16-10-6-4-7-11-16/h4-13,18-20,25H,14-15,23H2,1-3H3,(H,24,26)/t18-,19+,20-/m1/s1 |
| InChIKey | DBVORMANDZVFIG-HSALFYBXSA-N |
| XLogP | 3.05 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |