C9H15N7O5 — CID 147043964
3-[3-(3-hydrazinyl-3-oxopropyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]propanehydrazide (PubChem CID 147043964) has the molecular formula C9H15N7O5 and a molecular weight of 301.26 g/mol. Its IUPAC name is 3-[3-(3-hydrazinyl-3-oxopropyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]propanehydrazide.
| Compound Name | 3-[3-(3-hydrazinyl-3-oxopropyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]propanehydrazide |
|---|---|
| PubChem CID | 147043964 |
| Molecular Formula | C9H15N7O5 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 3-[3-(3-hydrazinyl-3-oxopropyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]propanehydrazide |
| SMILES | NNC(=O)CCn1c(=O)[nH]c(=O)n(CCC(=O)NN)c1=O |
| InChI | InChI=1S/C9H15N7O5/c10-13-5(17)1-3-15-7(19)12-8(20)16(9(15)21)4-2-6(18)14-11/h1-4,10-11H2,(H,13,17)(H,14,18)(H,12,19,20) |
| InChIKey | AZZQCLHCPZYSBH-UHFFFAOYSA-N |
| XLogP | -4.54 |
| TPSA | 187.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | -4.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|