C15H24N4O2S2 — CID 1470440
N-[5-[2-(cyclopentylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3,3-dimethylbutanamide (PubChem CID 1470440) has the molecular formula C15H24N4O2S2 and a molecular weight of 356.52 g/mol. Its IUPAC name is N-[5-[2-(cyclopentylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3,3-dimethylbutanamide.
| Compound Name | N-[5-[2-(cyclopentylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 1470440 |
| Molecular Formula | C15H24N4O2S2 |
| Molecular Weight | 356.52 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | N-[5-[2-(cyclopentylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3,3-dimethylbutanamide |
| SMILES | CC(C)(C)CC(=O)Nc1nnc(SCC(=O)NC2CCCC2)s1 |
| InChI | InChI=1S/C15H24N4O2S2/c1-15(2,3)8-11(20)17-13-18-19-14(23-13)22-9-12(21)16-10-6-4-5-7-10/h10H,4-9H2,1-3H3,(H,16,21)(H,17,18,20) |
| InChIKey | MCIFEMZVGGCYEB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.52 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|