About (2E,4E)-5-(furan-2-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one
(2E,4E)-5-(furan-2-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one (PubChem CID 147045454) has the molecular formula C14H17NO2
and a molecular weight of 231.30 g/mol. Its IUPAC name is (2E,4E)-5-(furan-2-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one.
Molecular Properties
| Compound Name | (2E,4E)-5-(furan-2-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one |
| PubChem CID | 147045454 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | (2E,4E)-5-(furan-2-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one |
| SMILES | O=C(/C=C/C=C/c1ccco1)N1CCCCC1 |
| InChI | InChI=1S/C14H17NO2/c16-14(15-10-4-1-5-11-15)9-3-2-7-13-8-6-12-17-13/h2-3,6-9,12H,1,4-5,10-11H2/b7-2+,9-3+ |
| InChIKey | BAGWBRRTKRACFE-XHAWQVTESA-N |
| XLogP | 2.86 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-5-(furan-2-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-5-(furan-2-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one?
The IUPAC name of (2E,4E)-5-(furan-2-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one (CID 147045454) is (2E,4E)-5-(furan-2-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one.
What is the SMILES notation for (2E,4E)-5-(furan-2-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one?
The canonical SMILES for (2E,4E)-5-(furan-2-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one is O=C(/C=C/C=C/c1ccco1)N1CCCCC1.
What is the InChIKey of (2E,4E)-5-(furan-2-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one?
The InChIKey is BAGWBRRTKRACFE-XHAWQVTESA-N. The full InChI is InChI=1S/C14H17NO2/c16-14(15-10-4-1-5-11-15)9-3-2-7-13-8-6-12-17-13/h2-3,6-9,12H,1,4-5,10-11H2/b7-2+,9-3+.
What are the key properties of (2E,4E)-5-(furan-2-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one?
(2E,4E)-5-(furan-2-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one has a molecular weight of 231.30 g/mol, XLogP of 2.86, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-5-(furan-2-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one is sourced from PubChem (CID 147045454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).