C38H28N10S2 — CID 147047411
2-N-[2-[[2-[(4-amino-6-naphthalen-2-yl-1,3,5-triazin-2-yl)amino]phenyl]disulfanyl]phenyl]-6-naphthalen-2-yl-1,3,5-triazine-2,4-diamine (PubChem CID 147047411) has the molecular formula C38H28N10S2 and a molecular weight of 688.85 g/mol. Its IUPAC name is 2-N-[2-[[2-[(4-amino-6-naphthalen-2-yl-1,3,5-triazin-2-yl)amino]phenyl]disulfanyl]phenyl]-6-naphthalen-2-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[2-[[2-[(4-amino-6-naphthalen-2-yl-1,3,5-triazin-2-yl)amino]phenyl]disulfanyl]phenyl]-6-naphthalen-2-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 147047411 |
| Molecular Formula | C38H28N10S2 |
| Molecular Weight | 688.85 g/mol |
| Exact Mass | 688.19 |
| IUPAC Name | 2-N-[2-[[2-[(4-amino-6-naphthalen-2-yl-1,3,5-triazin-2-yl)amino]phenyl]disulfanyl]phenyl]-6-naphthalen-2-yl-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(Nc2ccccc2SSc2ccccc2Nc2nc(N)nc(-c3ccc4ccccc4c3)n2)nc(-c2ccc3ccccc3c2)n1 |
| InChI | InChI=1S/C38H28N10S2/c39-35-43-33(27-19-17-23-9-1-3-11-25(23)21-27)45-37(47-35)41-29-13-5-7-15-31(29)49-50-32-16-8-6-14-30(32)42-38-46-34(44-36(40)48-38)28-20-18-24-10-2-4-12-26(24)22-28/h1-22H,(H3,39,41,43,45,47)(H3,40,42,44,46,48) |
| InChIKey | BAQQEPGQTCUDRM-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 153.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.85 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|