C12H20O4 — CID 14705336
[(2R)-2,3-dihydroxypropyl] (2E,4E,6S)-6-methylocta-2,4-dienoate (PubChem CID 14705336) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is [(2R)-2,3-dihydroxypropyl] (2E,4E,6S)-6-methylocta-2,4-dienoate.
| Compound Name | [(2R)-2,3-dihydroxypropyl] (2E,4E,6S)-6-methylocta-2,4-dienoate |
|---|---|
| PubChem CID | 14705336 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | [(2R)-2,3-dihydroxypropyl] (2E,4E,6S)-6-methylocta-2,4-dienoate |
| SMILES | CC[C@H](C)/C=C/C=C/C(=O)OC[C@H](O)CO |
| InChI | InChI=1S/C12H20O4/c1-3-10(2)6-4-5-7-12(15)16-9-11(14)8-13/h4-7,10-11,13-14H,3,8-9H2,1-2H3/b6-4+,7-5+/t10-,11+/m0/s1 |
| InChIKey | NOGDBKGCSWHQHI-SXAAAOJCSA-N |
| XLogP | 1.04 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|