C20H28N2O7 — CID 147053564
(2R,5S)-5-[[9-(2,5-dioxopyrrol-1-yl)-6-oxononanoyl]amino]-2-methyl-4-oxohexanoic acid (PubChem CID 147053564) has the molecular formula C20H28N2O7 and a molecular weight of 408.45 g/mol. Its IUPAC name is (2R,5S)-5-[[9-(2,5-dioxopyrrol-1-yl)-6-oxononanoyl]amino]-2-methyl-4-oxohexanoic acid.
| Compound Name | (2R,5S)-5-[[9-(2,5-dioxopyrrol-1-yl)-6-oxononanoyl]amino]-2-methyl-4-oxohexanoic acid |
|---|---|
| PubChem CID | 147053564 |
| Molecular Formula | C20H28N2O7 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | (2R,5S)-5-[[9-(2,5-dioxopyrrol-1-yl)-6-oxononanoyl]amino]-2-methyl-4-oxohexanoic acid |
| SMILES | C[C@H](CC(=O)[C@H](C)NC(=O)CCCCC(=O)CCCN1C(=O)C=CC1=O)C(=O)O |
| InChI | InChI=1S/C20H28N2O7/c1-13(20(28)29)12-16(24)14(2)21-17(25)8-4-3-6-15(23)7-5-11-22-18(26)9-10-19(22)27/h9-10,13-14H,3-8,11-12H2,1-2H3,(H,21,25)(H,28,29)/t13-,14+/m1/s1 |
| InChIKey | BBUHUFBXALBTFN-KGLIPLIRSA-N |
| XLogP | 1.01 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|