C15H26O5 — CID 14705405
methyl 2-[(2R,4R,5R,6S)-4-hydroxy-2-methoxy-5-methyl-6-[(E)-pent-2-en-2-yl]oxan-2-yl]acetate (PubChem CID 14705405) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is methyl 2-[(2R,4R,5R,6S)-4-hydroxy-2-methoxy-5-methyl-6-[(E)-pent-2-en-2-yl]oxan-2-yl]acetate.
| Compound Name | methyl 2-[(2R,4R,5R,6S)-4-hydroxy-2-methoxy-5-methyl-6-[(E)-pent-2-en-2-yl]oxan-2-yl]acetate |
|---|---|
| PubChem CID | 14705405 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | methyl 2-[(2R,4R,5R,6S)-4-hydroxy-2-methoxy-5-methyl-6-[(E)-pent-2-en-2-yl]oxan-2-yl]acetate |
| SMILES | CC/C=C(\C)[C@H]1O[C@](CC(=O)OC)(OC)C[C@@H](O)[C@H]1C |
| InChI | InChI=1S/C15H26O5/c1-6-7-10(2)14-11(3)12(16)8-15(19-5,20-14)9-13(17)18-4/h7,11-12,14,16H,6,8-9H2,1-5H3/b10-7+/t11-,12-,14-,15-/m1/s1 |
| InChIKey | KTEQHJGQHKNZQH-BNEFSDLTSA-N |
| XLogP | 2.03 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|