C20H28O2 — CID 14705435
(6E,10E,14E,15aS)-3,6,10,14-tetramethyl-5,8,9,12,13,15a-hexahydro-4H-cyclotetradeca[b]furan-2-one (PubChem CID 14705435) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (6E,10E,14E,15aS)-3,6,10,14-tetramethyl-5,8,9,12,13,15a-hexahydro-4H-cyclotetradeca[b]furan-2-one.
| Compound Name | (6E,10E,14E,15aS)-3,6,10,14-tetramethyl-5,8,9,12,13,15a-hexahydro-4H-cyclotetradeca[b]furan-2-one |
|---|---|
| PubChem CID | 14705435 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (6E,10E,14E,15aS)-3,6,10,14-tetramethyl-5,8,9,12,13,15a-hexahydro-4H-cyclotetradeca[b]furan-2-one |
| SMILES | CC1=C2CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/[C@@H]2OC1=O |
| InChI | InChI=1S/C20H28O2/c1-14-7-5-9-15(2)11-12-18-17(4)20(21)22-19(18)13-16(3)10-6-8-14/h8-9,13,19H,5-7,10-12H2,1-4H3/b14-8+,15-9+,16-13+/t19-/m0/s1 |
| InChIKey | ZFHCMDPHJINNOE-DKTDWJLLSA-N |
| XLogP | 5.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|