C20H30O2 — CID 14705439
(6E,14E)-3,6,10,14-tetramethyl-4,5,8,9,10,12,13,15a-octahydro-2H-cyclotetradeca[b]furan-11-one (PubChem CID 14705439) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (6E,14E)-3,6,10,14-tetramethyl-4,5,8,9,10,12,13,15a-octahydro-2H-cyclotetradeca[b]furan-11-one.
| Compound Name | (6E,14E)-3,6,10,14-tetramethyl-4,5,8,9,10,12,13,15a-octahydro-2H-cyclotetradeca[b]furan-11-one |
|---|---|
| PubChem CID | 14705439 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (6E,14E)-3,6,10,14-tetramethyl-4,5,8,9,10,12,13,15a-octahydro-2H-cyclotetradeca[b]furan-11-one |
| SMILES | CC1=C2CC/C(C)=C/CCC(C)C(=O)CC/C(C)=C/C2OC1 |
| InChI | InChI=1S/C20H30O2/c1-14-6-5-7-16(3)19(21)11-9-15(2)12-20-18(10-8-14)17(4)13-22-20/h6,12,16,20H,5,7-11,13H2,1-4H3/b14-6+,15-12+ |
| InChIKey | IIOBLRRZWCLQJK-BUJBXKITSA-N |
| XLogP | 5.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|