About 1-[2-(3-fluorophenyl)sulfanylpyrimidin-5-yl]-1,3-diazinane-2,4-dione
1-[2-(3-fluorophenyl)sulfanylpyrimidin-5-yl]-1,3-diazinane-2,4-dione (PubChem CID 147055537) has the molecular formula C14H11FN4O2S
and a molecular weight of 318.33 g/mol. Its IUPAC name is 1-[2-(3-fluorophenyl)sulfanylpyrimidin-5-yl]-1,3-diazinane-2,4-dione.
Molecular Properties
| Compound Name | 1-[2-(3-fluorophenyl)sulfanylpyrimidin-5-yl]-1,3-diazinane-2,4-dione |
| PubChem CID | 147055537 |
| Molecular Formula | C14H11FN4O2S |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 1-[2-(3-fluorophenyl)sulfanylpyrimidin-5-yl]-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCN(c2cnc(Sc3cccc(F)c3)nc2)C(=O)N1 |
| InChI | InChI=1S/C14H11FN4O2S/c15-9-2-1-3-11(6-9)22-13-16-7-10(8-17-13)19-5-4-12(20)18-14(19)21/h1-3,6-8H,4-5H2,(H,18,20,21) |
| InChIKey | BCDSSAQPXSOXOX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-(3-fluorophenyl)sulfanylpyrimidin-5-yl]-1,3-diazinane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(3-fluorophenyl)sulfanylpyrimidin-5-yl]-1,3-diazinane-2,4-dione?
The IUPAC name of 1-[2-(3-fluorophenyl)sulfanylpyrimidin-5-yl]-1,3-diazinane-2,4-dione (CID 147055537) is 1-[2-(3-fluorophenyl)sulfanylpyrimidin-5-yl]-1,3-diazinane-2,4-dione.
What is the SMILES notation for 1-[2-(3-fluorophenyl)sulfanylpyrimidin-5-yl]-1,3-diazinane-2,4-dione?
The canonical SMILES for 1-[2-(3-fluorophenyl)sulfanylpyrimidin-5-yl]-1,3-diazinane-2,4-dione is O=C1CCN(c2cnc(Sc3cccc(F)c3)nc2)C(=O)N1.
What is the InChIKey of 1-[2-(3-fluorophenyl)sulfanylpyrimidin-5-yl]-1,3-diazinane-2,4-dione?
The InChIKey is BCDSSAQPXSOXOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11FN4O2S/c15-9-2-1-3-11(6-9)22-13-16-7-10(8-17-13)19-5-4-12(20)18-14(19)21/h1-3,6-8H,4-5H2,(H,18,20,21).
What are the key properties of 1-[2-(3-fluorophenyl)sulfanylpyrimidin-5-yl]-1,3-diazinane-2,4-dione?
1-[2-(3-fluorophenyl)sulfanylpyrimidin-5-yl]-1,3-diazinane-2,4-dione has a molecular weight of 318.33 g/mol, XLogP of 2.21, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(3-fluorophenyl)sulfanylpyrimidin-5-yl]-1,3-diazinane-2,4-dione is sourced from PubChem (CID 147055537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).