C25H25ClN4O2S — CID 147057950
3-[2-[4-(azepane-1-carboximidoyl)phenyl]-2-oxoethyl]-N-(5-chloro-2-pyridinyl)thiophene-2-carboxamide (PubChem CID 147057950) has the molecular formula C25H25ClN4O2S and a molecular weight of 481.02 g/mol. Its IUPAC name is 3-[2-[4-(azepane-1-carboximidoyl)phenyl]-2-oxoethyl]-N-(5-chloro-2-pyridinyl)thiophene-2-carboxamide.
| Compound Name | 3-[2-[4-(azepane-1-carboximidoyl)phenyl]-2-oxoethyl]-N-(5-chloro-2-pyridinyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 147057950 |
| Molecular Formula | C25H25ClN4O2S |
| Molecular Weight | 481.02 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 3-[2-[4-(azepane-1-carboximidoyl)phenyl]-2-oxoethyl]-N-(5-chloro-2-pyridinyl)thiophene-2-carboxamide |
| SMILES | [H]/N=C(\c1ccc(C(=O)Cc2ccsc2C(=O)Nc2ccc(Cl)cn2)cc1)N1CCCCCC1 |
| InChI | InChI=1S/C25H25ClN4O2S/c26-20-9-10-22(28-16-20)29-25(32)23-19(11-14-33-23)15-21(31)17-5-7-18(8-6-17)24(27)30-12-3-1-2-4-13-30/h5-11,14,16,27H,1-4,12-13,15H2,(H,28,29,32)/b27-24+ |
| InChIKey | BCPQMDZFMKMXMD-SOYKGTTHSA-N |
| XLogP | 5.68 |
| TPSA | 86.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.02 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|