About 3-(4-fluorophenyl)-5,6-dihydro-1H-pyrazolo[4,3-b]pyridine
3-(4-fluorophenyl)-5,6-dihydro-1H-pyrazolo[4,3-b]pyridine (PubChem CID 147060021) has the molecular formula C12H10FN3
and a molecular weight of 215.23 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-5,6-dihydro-1H-pyrazolo[4,3-b]pyridine.
Molecular Properties
| Compound Name | 3-(4-fluorophenyl)-5,6-dihydro-1H-pyrazolo[4,3-b]pyridine |
| PubChem CID | 147060021 |
| Molecular Formula | C12H10FN3 |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 3-(4-fluorophenyl)-5,6-dihydro-1H-pyrazolo[4,3-b]pyridine |
| SMILES | Fc1ccc(-c2n[nH]c3c2=NCCC=3)cc1 |
| InChI | InChI=1S/C12H10FN3/c13-9-5-3-8(4-6-9)11-12-10(15-16-11)2-1-7-14-12/h2-6,15H,1,7H2 |
| InChIKey | BCZKIGMDRWYJNI-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 41.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-fluorophenyl)-5,6-dihydro-1H-pyrazolo[4,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluorophenyl)-5,6-dihydro-1H-pyrazolo[4,3-b]pyridine?
The IUPAC name of 3-(4-fluorophenyl)-5,6-dihydro-1H-pyrazolo[4,3-b]pyridine (CID 147060021) is 3-(4-fluorophenyl)-5,6-dihydro-1H-pyrazolo[4,3-b]pyridine.
What is the SMILES notation for 3-(4-fluorophenyl)-5,6-dihydro-1H-pyrazolo[4,3-b]pyridine?
The canonical SMILES for 3-(4-fluorophenyl)-5,6-dihydro-1H-pyrazolo[4,3-b]pyridine is Fc1ccc(-c2n[nH]c3c2=NCCC=3)cc1.
What is the InChIKey of 3-(4-fluorophenyl)-5,6-dihydro-1H-pyrazolo[4,3-b]pyridine?
The InChIKey is BCZKIGMDRWYJNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10FN3/c13-9-5-3-8(4-6-9)11-12-10(15-16-11)2-1-7-14-12/h2-6,15H,1,7H2.
What are the key properties of 3-(4-fluorophenyl)-5,6-dihydro-1H-pyrazolo[4,3-b]pyridine?
3-(4-fluorophenyl)-5,6-dihydro-1H-pyrazolo[4,3-b]pyridine has a molecular weight of 215.23 g/mol, XLogP of 1.02, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorophenyl)-5,6-dihydro-1H-pyrazolo[4,3-b]pyridine is sourced from PubChem (CID 147060021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).